C16H12Cl2INO4 — CID 168650228
dimethyl 1-(2,6-dichloro-4-iodophenyl)azepine-2,3-dicarboxylate (PubChem CID 168650228) has the molecular formula C16H12Cl2INO4 and a molecular weight of 480.09 g/mol. Its IUPAC name is dimethyl 1-(2,6-dichloro-4-iodophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2,6-dichloro-4-iodophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650228 |
| Molecular Formula | C16H12Cl2INO4 |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 478.92 |
| IUPAC Name | dimethyl 1-(2,6-dichloro-4-iodophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Cl)cc(I)cc2Cl)C=CC=C1 |
| InChI | InChI=1S/C16H12Cl2INO4/c1-23-15(21)10-5-3-4-6-20(13(10)16(22)24-2)14-11(17)7-9(19)8-12(14)18/h3-8H,1-2H3 |
| InChIKey | UMCNDJSXVNWIKO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|