C18H18ClNO4 — CID 168648723
dimethyl 1-(3-chloro-2,6-dimethylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168648723) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is dimethyl 1-(3-chloro-2,6-dimethylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-chloro-2,6-dimethylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648723 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | dimethyl 1-(3-chloro-2,6-dimethylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(C)ccc(Cl)c2C)C=CC=C1 |
| InChI | InChI=1S/C18H18ClNO4/c1-11-8-9-14(19)12(2)15(11)20-10-6-5-7-13(17(21)23-3)16(20)18(22)24-4/h5-10H,1-4H3 |
| InChIKey | ZIARVURSRPRINK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |