C24H20ClNO5 — CID 168650478
dimethyl 1-[2-chloro-5-(4-methylbenzoyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650478) has the molecular formula C24H20ClNO5 and a molecular weight of 437.88 g/mol. Its IUPAC name is dimethyl 1-[2-chloro-5-(4-methylbenzoyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-chloro-5-(4-methylbenzoyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650478 |
| Molecular Formula | C24H20ClNO5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | dimethyl 1-[2-chloro-5-(4-methylbenzoyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(=O)c3ccc(C)cc3)ccc2Cl)C=CC=C1 |
| InChI | InChI=1S/C24H20ClNO5/c1-15-7-9-16(10-8-15)22(27)17-11-12-19(25)20(14-17)26-13-5-4-6-18(23(28)30-2)21(26)24(29)31-3/h4-14H,1-3H3 |
| InChIKey | JYCJLWFMLWMFMV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |