C16H13ClN2O7 — CID 168650419
dimethyl 1-(5-chloro-2-hydroxy-4-nitrophenyl)azepine-2,3-dicarboxylate (PubChem CID 168650419) has the molecular formula C16H13ClN2O7 and a molecular weight of 380.74 g/mol. Its IUPAC name is dimethyl 1-(5-chloro-2-hydroxy-4-nitrophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(5-chloro-2-hydroxy-4-nitrophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650419 |
| Molecular Formula | C16H13ClN2O7 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | dimethyl 1-(5-chloro-2-hydroxy-4-nitrophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Cl)c([N+](=O)[O-])cc2O)C=CC=C1 |
| InChI | InChI=1S/C16H13ClN2O7/c1-25-15(21)9-5-3-4-6-18(14(9)16(22)26-2)12-7-10(17)11(19(23)24)8-13(12)20/h3-8,20H,1-2H3 |
| InChIKey | AKUZNFWIVLVDQQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|