C17H14N2O8 — CID 168648096
dimethyl 1-(6-nitro-1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168648096) has the molecular formula C17H14N2O8 and a molecular weight of 374.31 g/mol. Its IUPAC name is dimethyl 1-(6-nitro-1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(6-nitro-1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648096 |
| Molecular Formula | C17H14N2O8 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | dimethyl 1-(6-nitro-1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc3c(cc2[N+](=O)[O-])OCO3)C=CC=C1 |
| InChI | InChI=1S/C17H14N2O8/c1-24-16(20)10-5-3-4-6-18(15(10)17(21)25-2)11-7-13-14(27-9-26-13)8-12(11)19(22)23/h3-8H,9H2,1-2H3 |
| InChIKey | YVIGVNRDMMYXGE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|