C17H15BrN2O6 — CID 168650721
dimethyl 1-[2-(bromomethyl)-3-nitrophenyl]azepine-2,3-dicarboxylate (PubChem CID 168650721) has the molecular formula C17H15BrN2O6 and a molecular weight of 423.22 g/mol. Its IUPAC name is dimethyl 1-[2-(bromomethyl)-3-nitrophenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(bromomethyl)-3-nitrophenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650721 |
| Molecular Formula | C17H15BrN2O6 |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | dimethyl 1-[2-(bromomethyl)-3-nitrophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc([N+](=O)[O-])c2CBr)C=CC=C1 |
| InChI | InChI=1S/C17H15BrN2O6/c1-25-16(21)11-6-3-4-9-19(15(11)17(22)26-2)13-7-5-8-14(20(23)24)12(13)10-18/h3-9H,10H2,1-2H3 |
| InChIKey | NSVHRLBDYHKPCI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|