C16H12FN3O8 — CID 168646435
dimethyl 1-(5-fluoro-2,4-dinitrophenyl)azepine-2,3-dicarboxylate (PubChem CID 168646435) has the molecular formula C16H12FN3O8 and a molecular weight of 393.28 g/mol. Its IUPAC name is dimethyl 1-(5-fluoro-2,4-dinitrophenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(5-fluoro-2,4-dinitrophenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646435 |
| Molecular Formula | C16H12FN3O8 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | dimethyl 1-(5-fluoro-2,4-dinitrophenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])C=CC=C1 |
| InChI | InChI=1S/C16H12FN3O8/c1-27-15(21)9-5-3-4-6-18(14(9)16(22)28-2)12-7-10(17)11(19(23)24)8-13(12)20(25)26/h3-8H,1-2H3 |
| InChIKey | XILDLPGPDHUYOV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|