C22H25N3O7 — CID 168646747
dimethyl 1-[4-(2,6-dimethylmorpholin-4-yl)-3-nitrophenyl]azepine-2,3-dicarboxylate (PubChem CID 168646747) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is dimethyl 1-[4-(2,6-dimethylmorpholin-4-yl)-3-nitrophenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(2,6-dimethylmorpholin-4-yl)-3-nitrophenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646747 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | dimethyl 1-[4-(2,6-dimethylmorpholin-4-yl)-3-nitrophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CC(C)OC(C)C3)c([N+](=O)[O-])c2)C=CC=C1 |
| InChI | InChI=1S/C22H25N3O7/c1-14-12-23(13-15(2)32-14)18-9-8-16(11-19(18)25(28)29)24-10-6-5-7-17(21(26)30-3)20(24)22(27)31-4/h5-11,14-15H,12-13H2,1-4H3 |
| InChIKey | CETWNTMJTUZCAK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|