C17H15NO6 — CID 168650169
dimethyl 1-(1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168650169) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is dimethyl 1-(1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650169 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | dimethyl 1-(1,3-benzodioxol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)OCO3)C=CC=C1 |
| InChI | InChI=1S/C17H15NO6/c1-21-16(19)12-5-3-4-8-18(15(12)17(20)22-2)11-6-7-13-14(9-11)24-10-23-13/h3-9H,10H2,1-2H3 |
| InChIKey | YDXGEOUTHZZQPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |