C22H25BFNO6 — CID 168650275
dimethyl 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650275) has the molecular formula C22H25BFNO6 and a molecular weight of 429.25 g/mol. Its IUPAC name is dimethyl 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650275 |
| Molecular Formula | C22H25BFNO6 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | dimethyl 1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(F)c(B3OC(C)(C)C(C)(C)O3)c2)C=CC=C1 |
| InChI | InChI=1S/C22H25BFNO6/c1-21(2)22(3,4)31-23(30-21)16-13-14(10-11-17(16)24)25-12-8-7-9-15(19(26)28-5)18(25)20(27)29-6/h7-13H,1-6H3 |
| InChIKey | BHVUOJLYMMDRQL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|