C23H28BNO7 — CID 168648572
dimethyl 1-[2-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648572) has the molecular formula C23H28BNO7 and a molecular weight of 441.29 g/mol. Its IUPAC name is dimethyl 1-[2-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648572 |
| Molecular Formula | C23H28BNO7 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | dimethyl 1-[2-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2CO)C=CC=C1 |
| InChI | InChI=1S/C23H28BNO7/c1-22(2)23(3,4)32-24(31-22)16-10-11-18(15(13-16)14-26)25-12-8-7-9-17(20(27)29-5)19(25)21(28)30-6/h7-13,26H,14H2,1-6H3 |
| InChIKey | ORONSJZMPLPBBJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|