C17H14N2O4S — CID 168648446
dimethyl 1-(2,1-benzothiazol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168648446) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is dimethyl 1-(2,1-benzothiazol-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2,1-benzothiazol-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648446 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | dimethyl 1-(2,1-benzothiazol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3nscc3c2)C=CC=C1 |
| InChI | InChI=1S/C17H14N2O4S/c1-22-16(20)13-5-3-4-8-19(15(13)17(21)23-2)12-6-7-14-11(9-12)10-24-18-14/h3-10H,1-2H3 |
| InChIKey | KLKUWDRWPUSANL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |