C17H16N4O4 — CID 168647233
dimethyl 1-(1-methylbenzotriazol-5-yl)azepine-2,3-dicarboxylate (PubChem CID 168647233) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is dimethyl 1-(1-methylbenzotriazol-5-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(1-methylbenzotriazol-5-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647233 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | dimethyl 1-(1-methylbenzotriazol-5-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)nnn3C)C=CC=C1 |
| InChI | InChI=1S/C17H16N4O4/c1-20-14-8-7-11(10-13(14)18-19-20)21-9-5-4-6-12(16(22)24-2)15(21)17(23)25-3/h4-10H,1-3H3 |
| InChIKey | KWHRFXPWDNLHKR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |