C20H20N2O4 — CID 168648616
dimethyl 1-(1,3-dimethylindol-6-yl)azepine-2,3-dicarboxylate (PubChem CID 168648616) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is dimethyl 1-(1,3-dimethylindol-6-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(1,3-dimethylindol-6-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648616 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | dimethyl 1-(1,3-dimethylindol-6-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(C)cn(C)c3c2)C=CC=C1 |
| InChI | InChI=1S/C20H20N2O4/c1-13-12-21(2)17-11-14(8-9-15(13)17)22-10-6-5-7-16(19(23)25-3)18(22)20(24)26-4/h5-12H,1-4H3 |
| InChIKey | PUFUYRXVDZZFDO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |