About dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate
dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate (PubChem CID 168648744) has the molecular formula C25H23N3O5
and a molecular weight of 445.48 g/mol. Its IUPAC name is dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate |
| PubChem CID | 168648744 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)nc(-c2ccccc2)n3CCO)C=CC=C1 |
| InChI | InChI=1S/C25H23N3O5/c1-32-24(30)19-10-6-7-13-27(22(19)25(31)33-2)18-11-12-21-20(16-18)26-23(28(21)14-15-29)17-8-4-3-5-9-17/h3-13,16,29H,14-15H2,1-2H3 |
| InChIKey | AUQVBUDYXANMNU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate (CID 168648744) is dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)nc(-c2ccccc2)n3CCO)C=CC=C1.
What is the InChIKey of dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate?
The InChIKey is AUQVBUDYXANMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O5/c1-32-24(30)19-10-6-7-13-27(22(19)25(31)33-2)18-11-12-21-20(16-18)26-23(28(21)14-15-29)17-8-4-3-5-9-17/h3-13,16,29H,14-15H2,1-2H3.
What are the key properties of dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate?
dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate has a molecular weight of 445.48 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-[1-(2-hydroxyethyl)-2-phenylbenzimidazol-5-yl]azepine-2,3-dicarboxylate is sourced from PubChem (CID 168648744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).