C23H18N2O5 — CID 168648395
dimethyl 1-[3-(1,3-benzoxazol-2-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648395) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is dimethyl 1-[3-(1,3-benzoxazol-2-yl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-(1,3-benzoxazol-2-yl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648395 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | dimethyl 1-[3-(1,3-benzoxazol-2-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(-c3nc4ccccc4o3)c2)C=CC=C1 |
| InChI | InChI=1S/C23H18N2O5/c1-28-22(26)17-10-5-6-13-25(20(17)23(27)29-2)16-9-7-8-15(14-16)21-24-18-11-3-4-12-19(18)30-21/h3-14H,1-2H3 |
| InChIKey | GKTUBRUSVKDENA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |