C28H21NO5 — CID 168646290
dimethyl 1-(4-dibenzofuran-4-ylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168646290) has the molecular formula C28H21NO5 and a molecular weight of 451.48 g/mol. Its IUPAC name is dimethyl 1-(4-dibenzofuran-4-ylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-dibenzofuran-4-ylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646290 |
| Molecular Formula | C28H21NO5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | dimethyl 1-(4-dibenzofuran-4-ylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)C=CC=C1 |
| InChI | InChI=1S/C28H21NO5/c1-32-27(30)23-9-5-6-17-29(25(23)28(31)33-2)19-15-13-18(14-16-19)20-10-7-11-22-21-8-3-4-12-24(21)34-26(20)22/h3-17H,1-2H3 |
| InChIKey | WEWHWCPMKYGANA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |