C25H17N3O3 — CID 168546001
methyl 3-amino-4-cyano-1-(4-dibenzofuran-4-ylphenyl)pyrrole-2-carboxylate (PubChem CID 168546001) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-dibenzofuran-4-ylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-dibenzofuran-4-ylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546001 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-dibenzofuran-4-ylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C25H17N3O3/c1-30-25(29)23-22(27)16(13-26)14-28(23)17-11-9-15(10-12-17)18-6-4-7-20-19-5-2-3-8-21(19)31-24(18)20/h2-12,14H,27H2,1H3 |
| InChIKey | BIHSXJCLUZFDAG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |