C23H17N5O3 — CID 168546636
methyl 3-amino-1-[4-(4-carbamoylquinolin-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168546636) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is methyl 3-amino-1-[4-(4-carbamoylquinolin-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[4-(4-carbamoylquinolin-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546636 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 3-amino-1-[4-(4-carbamoylquinolin-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(-c2cc(C(N)=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H17N5O3/c1-31-23(30)21-20(25)14(11-24)12-28(21)15-8-6-13(7-9-15)19-10-17(22(26)29)16-4-2-3-5-18(16)27-19/h2-10,12H,25H2,1H3,(H2,26,29) |
| InChIKey | UNTDDZLQAYCRMD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |