C26H20N2O6 — CID 168649506
2-[4-[2,3-bis(methoxycarbonyl)azepin-1-yl]phenyl]quinoline-4-carboxylic acid (PubChem CID 168649506) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-[4-[2,3-bis(methoxycarbonyl)azepin-1-yl]phenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[4-[2,3-bis(methoxycarbonyl)azepin-1-yl]phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168649506 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[4-[2,3-bis(methoxycarbonyl)azepin-1-yl]phenyl]quinoline-4-carboxylic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(-c3cc(C(=O)O)c4ccccc4n3)cc2)C=CC=C1 |
| InChI | InChI=1S/C26H20N2O6/c1-33-25(31)19-8-5-6-14-28(23(19)26(32)34-2)17-12-10-16(11-13-17)22-15-20(24(29)30)18-7-3-4-9-21(18)27-22/h3-15H,1-2H3,(H,29,30) |
| InChIKey | FFIHANDXQPJTBP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |