C18H14ClN3O4 — CID 168647656
dimethyl 1-(4-chloroquinazolin-6-yl)azepine-2,3-dicarboxylate (PubChem CID 168647656) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is dimethyl 1-(4-chloroquinazolin-6-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-chloroquinazolin-6-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647656 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | dimethyl 1-(4-chloroquinazolin-6-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3ncnc(Cl)c3c2)C=CC=C1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-25-17(23)12-5-3-4-8-22(15(12)18(24)26-2)11-6-7-14-13(9-11)16(19)21-10-20-14/h3-10H,1-2H3 |
| InChIKey | LXAOADRIISEETM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |