C21H24N2O4 — CID 168647555
dimethyl 1-(2-methyl-4-pyrrolidin-1-ylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168647555) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is dimethyl 1-(2-methyl-4-pyrrolidin-1-ylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-methyl-4-pyrrolidin-1-ylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647555 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | dimethyl 1-(2-methyl-4-pyrrolidin-1-ylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(N3CCCC3)cc2C)C=CC=C1 |
| InChI | InChI=1S/C21H24N2O4/c1-15-14-16(22-11-6-7-12-22)9-10-18(15)23-13-5-4-8-17(20(24)26-2)19(23)21(25)27-3/h4-5,8-10,13-14H,6-7,11-12H2,1-3H3 |
| InChIKey | MXUUZWVMVMZTMI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|