C20H23N3O4 — CID 168648293
dimethyl 1-(3-piperazin-1-ylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168648293) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is dimethyl 1-(3-piperazin-1-ylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-piperazin-1-ylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648293 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | dimethyl 1-(3-piperazin-1-ylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(N3CCNCC3)c2)C=CC=C1 |
| InChI | InChI=1S/C20H23N3O4/c1-26-19(24)17-8-3-4-11-23(18(17)20(25)27-2)16-7-5-6-15(14-16)22-12-9-21-10-13-22/h3-8,11,14,21H,9-10,12-13H2,1-2H3 |
| InChIKey | RWOIXADJZATEGS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |