C18H19NO6 — CID 168648284
dimethyl 1-[3-(methoxymethoxy)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648284) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is dimethyl 1-[3-(methoxymethoxy)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-(methoxymethoxy)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648284 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | dimethyl 1-[3-(methoxymethoxy)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COCOc1cccc(N2C=CC=CC(C(=O)OC)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C18H19NO6/c1-22-12-25-14-8-6-7-13(11-14)19-10-5-4-9-15(17(20)23-2)16(19)18(21)24-3/h4-11H,12H2,1-3H3 |
| InChIKey | WTPURQUFHZYLIS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|