C23H20ClNO5 — CID 168648163
dimethyl 1-[3-[(4-chlorophenoxy)methyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648163) has the molecular formula C23H20ClNO5 and a molecular weight of 425.87 g/mol. Its IUPAC name is dimethyl 1-[3-[(4-chlorophenoxy)methyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-[(4-chlorophenoxy)methyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648163 |
| Molecular Formula | C23H20ClNO5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | dimethyl 1-[3-[(4-chlorophenoxy)methyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(COc3ccc(Cl)cc3)c2)C=CC=C1 |
| InChI | InChI=1S/C23H20ClNO5/c1-28-22(26)20-8-3-4-13-25(21(20)23(27)29-2)18-7-5-6-16(14-18)15-30-19-11-9-17(24)10-12-19/h3-14H,15H2,1-2H3 |
| InChIKey | MHEVHNBDEDNBSL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |