C23H20FNO5 — CID 168648259
dimethyl 1-[4-[(3-fluorophenyl)methoxy]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648259) has the molecular formula C23H20FNO5 and a molecular weight of 409.41 g/mol. Its IUPAC name is dimethyl 1-[4-[(3-fluorophenyl)methoxy]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[(3-fluorophenyl)methoxy]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648259 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | dimethyl 1-[4-[(3-fluorophenyl)methoxy]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(OCc3cccc(F)c3)cc2)C=CC=C1 |
| InChI | InChI=1S/C23H20FNO5/c1-28-22(26)20-8-3-4-13-25(21(20)23(27)29-2)18-9-11-19(12-10-18)30-15-16-6-5-7-17(24)14-16/h3-14H,15H2,1-2H3 |
| InChIKey | UQLHJVBZLLZDCV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |