C22H17ClFNO5 — CID 168649201
dimethyl 1-[5-chloro-2-(3-fluorophenoxy)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649201) has the molecular formula C22H17ClFNO5 and a molecular weight of 429.83 g/mol. Its IUPAC name is dimethyl 1-[5-chloro-2-(3-fluorophenoxy)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[5-chloro-2-(3-fluorophenoxy)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649201 |
| Molecular Formula | C22H17ClFNO5 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | dimethyl 1-[5-chloro-2-(3-fluorophenoxy)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Cl)ccc2Oc2cccc(F)c2)C=CC=C1 |
| InChI | InChI=1S/C22H17ClFNO5/c1-28-21(26)17-8-3-4-11-25(20(17)22(27)29-2)18-12-14(23)9-10-19(18)30-16-7-5-6-15(24)13-16/h3-13H,1-2H3 |
| InChIKey | ZIHZNEYZGSSCSM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |