C19H15ClN2O4 — CID 168646749
dimethyl 1-(3-chloroquinolin-8-yl)azepine-2,3-dicarboxylate (PubChem CID 168646749) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is dimethyl 1-(3-chloroquinolin-8-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-chloroquinolin-8-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168646749 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | dimethyl 1-(3-chloroquinolin-8-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc3cc(Cl)cnc23)C=CC=C1 |
| InChI | InChI=1S/C19H15ClN2O4/c1-25-18(23)14-7-3-4-9-22(17(14)19(24)26-2)15-8-5-6-12-10-13(20)11-21-16(12)15/h3-11H,1-2H3 |
| InChIKey | QBWAPLZCVNRPOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |