C17H14ClN3O4 — CID 168647965
dimethyl 1-(5-chloro-1H-indazol-6-yl)azepine-2,3-dicarboxylate (PubChem CID 168647965) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is dimethyl 1-(5-chloro-1H-indazol-6-yl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(5-chloro-1H-indazol-6-yl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647965 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | dimethyl 1-(5-chloro-1H-indazol-6-yl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc3[nH]ncc3cc2Cl)C=CC=C1 |
| InChI | InChI=1S/C17H14ClN3O4/c1-24-16(22)11-5-3-4-6-21(15(11)17(23)25-2)14-8-13-10(7-12(14)18)9-19-20-13/h3-9H,1-2H3,(H,19,20) |
| InChIKey | ZCGHDSDKAZBEEK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |