C16H14BrNO4S — CID 168647940
dimethyl 1-(3-bromo-2-sulfanylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168647940) has the molecular formula C16H14BrNO4S and a molecular weight of 396.26 g/mol. Its IUPAC name is dimethyl 1-(3-bromo-2-sulfanylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-bromo-2-sulfanylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647940 |
| Molecular Formula | C16H14BrNO4S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | dimethyl 1-(3-bromo-2-sulfanylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(Br)c2S)C=CC=C1 |
| InChI | InChI=1S/C16H14BrNO4S/c1-21-15(19)10-6-3-4-9-18(13(10)16(20)22-2)12-8-5-7-11(17)14(12)23/h3-9,23H,1-2H3 |
| InChIKey | VKDVCWUTUKXAKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|