C22H19FN2O6S — CID 168649004
dimethyl 1-[4-[(2-fluorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649004) has the molecular formula C22H19FN2O6S and a molecular weight of 458.47 g/mol. Its IUPAC name is dimethyl 1-[4-[(2-fluorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[(2-fluorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649004 |
| Molecular Formula | C22H19FN2O6S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | dimethyl 1-[4-[(2-fluorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)Nc3ccccc3F)cc2)C=CC=C1 |
| InChI | InChI=1S/C22H19FN2O6S/c1-30-21(26)17-7-5-6-14-25(20(17)22(27)31-2)15-10-12-16(13-11-15)32(28,29)24-19-9-4-3-8-18(19)23/h3-14,24H,1-2H3 |
| InChIKey | WYTZJTNKEASKIT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |