C24H22N2O6 — CID 168650210
dimethyl 1-[4-(phenylmethoxycarbonylamino)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650210) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is dimethyl 1-[4-(phenylmethoxycarbonylamino)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(phenylmethoxycarbonylamino)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650210 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | dimethyl 1-[4-(phenylmethoxycarbonylamino)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(NC(=O)OCc3ccccc3)cc2)C=CC=C1 |
| InChI | InChI=1S/C24H22N2O6/c1-30-22(27)20-10-6-7-15-26(21(20)23(28)31-2)19-13-11-18(12-14-19)25-24(29)32-16-17-8-4-3-5-9-17/h3-15H,16H2,1-2H3,(H,25,29) |
| InChIKey | QXIRXCYIIPZSKE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|