C16H15FN2O6S — CID 168649797
dimethyl 1-(2-fluoro-6-sulfamoylphenyl)azepine-2,3-dicarboxylate (PubChem CID 168649797) has the molecular formula C16H15FN2O6S and a molecular weight of 382.37 g/mol. Its IUPAC name is dimethyl 1-(2-fluoro-6-sulfamoylphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-fluoro-6-sulfamoylphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649797 |
| Molecular Formula | C16H15FN2O6S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | dimethyl 1-(2-fluoro-6-sulfamoylphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(F)cccc2S(N)(=O)=O)C=CC=C1 |
| InChI | InChI=1S/C16H15FN2O6S/c1-24-15(20)10-6-3-4-9-19(13(10)16(21)25-2)14-11(17)7-5-8-12(14)26(18,22)23/h3-9H,1-2H3,(H2,18,22,23) |
| InChIKey | AMSHIXBRUOPYQQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |