C22H19NO6S — CID 168650765
dimethyl 1-[2-(benzenesulfonyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168650765) has the molecular formula C22H19NO6S and a molecular weight of 425.46 g/mol. Its IUPAC name is dimethyl 1-[2-(benzenesulfonyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(benzenesulfonyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650765 |
| Molecular Formula | C22H19NO6S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | dimethyl 1-[2-(benzenesulfonyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2S(=O)(=O)c2ccccc2)C=CC=C1 |
| InChI | InChI=1S/C22H19NO6S/c1-28-21(24)17-12-8-9-15-23(20(17)22(25)29-2)18-13-6-7-14-19(18)30(26,27)16-10-4-3-5-11-16/h3-15H,1-2H3 |
| InChIKey | XJWWAERJEZFVTM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |