C20H24N2O6S — CID 168649821
dimethyl 1-[2-(diethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649821) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is dimethyl 1-[2-(diethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(diethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649821 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | dimethyl 1-[2-(diethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccccc1N1C=CC=CC(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C20H24N2O6S/c1-5-21(6-2)29(25,26)17-13-8-7-12-16(17)22-14-10-9-11-15(19(23)27-3)18(22)20(24)28-4/h7-14H,5-6H2,1-4H3 |
| InChIKey | JEDIDCNZLRQUFC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |