C24H24N2O5 — CID 168647009
dimethyl 1-[2-(2-phenoxyethylamino)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168647009) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is dimethyl 1-[2-(2-phenoxyethylamino)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[2-(2-phenoxyethylamino)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647009 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | dimethyl 1-[2-(2-phenoxyethylamino)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2NCCOc2ccccc2)C=CC=C1 |
| InChI | InChI=1S/C24H24N2O5/c1-29-23(27)19-12-8-9-16-26(22(19)24(28)30-2)21-14-7-6-13-20(21)25-15-17-31-18-10-4-3-5-11-18/h3-14,16,25H,15,17H2,1-2H3 |
| InChIKey | VAPOYQCKKPABEH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|