C16H14N2O9S — CID 168646219
2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzenesulfonic acid (PubChem CID 168646219) has the molecular formula C16H14N2O9S and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzenesulfonic acid.
| Compound Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168646219 |
| Molecular Formula | C16H14N2O9S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[2,3-bis(methoxycarbonyl)azepin-1-yl]-5-nitrobenzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)C=CC=C1 |
| InChI | InChI=1S/C16H14N2O9S/c1-26-15(19)11-5-3-4-8-17(14(11)16(20)27-2)12-7-6-10(18(21)22)9-13(12)28(23,24)25/h3-9H,1-2H3,(H,23,24,25) |
| InChIKey | LTFUIJXIHQIUTO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|