About dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate
dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate (PubChem CID 168649496) has the molecular formula C18H17N3O9
and a molecular weight of 419.35 g/mol. Its IUPAC name is dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate |
| PubChem CID | 168649496 |
| Molecular Formula | C18H17N3O9 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2CCO)C=CC=C1 |
| InChI | InChI=1S/C18H17N3O9/c1-29-17(23)13-5-3-4-7-19(16(13)18(24)30-2)14-9-11(20(25)26)10-15(21(27)28)12(14)6-8-22/h3-5,7,9-10,22H,6,8H2,1-2H3 |
| InChIKey | JCXPAIAZRQQSKR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate (CID 168649496) is dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2CCO)C=CC=C1.
What is the InChIKey of dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate?
The InChIKey is JCXPAIAZRQQSKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O9/c1-29-17(23)13-5-3-4-7-19(16(13)18(24)30-2)14-9-11(20(25)26)10-15(21(27)28)12(14)6-8-22/h3-5,7,9-10,22H,6,8H2,1-2H3.
What are the key properties of dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate?
dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate has a molecular weight of 419.35 g/mol, XLogP of 1.53, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-[2-(2-hydroxyethyl)-3,5-dinitrophenyl]azepine-2,3-dicarboxylate is sourced from PubChem (CID 168649496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).