C18H15F3N2O7 — CID 168649408
dimethyl 1-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168649408) has the molecular formula C18H15F3N2O7 and a molecular weight of 428.32 g/mol. Its IUPAC name is dimethyl 1-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649408 |
| Molecular Formula | C18H15F3N2O7 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | dimethyl 1-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(OCC(F)(F)F)cc([N+](=O)[O-])c2)C=CC=C1 |
| InChI | InChI=1S/C18H15F3N2O7/c1-28-16(24)14-5-3-4-6-22(15(14)17(25)29-2)11-7-12(23(26)27)9-13(8-11)30-10-18(19,20)21/h3-9H,10H2,1-2H3 |
| InChIKey | YGVUKKXBAVRILN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|