C24H22N2O7 — CID 168648468
dimethyl 1-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]azepine-2,3-dicarboxylate (PubChem CID 168648468) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is dimethyl 1-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648468 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | dimethyl 1-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Oc3cc(C)ccc3C)cc([N+](=O)[O-])c2)C=CC=C1 |
| InChI | InChI=1S/C24H22N2O7/c1-15-8-9-16(2)21(11-15)33-19-13-17(12-18(14-19)26(29)30)25-10-6-5-7-20(23(27)31-3)22(25)24(28)32-4/h5-14H,1-4H3 |
| InChIKey | CSJNUFLNOAIICR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|