C21H24N2O7S — CID 168648999
dimethyl 1-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648999) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is dimethyl 1-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648999 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | dimethyl 1-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)NCC3CCCO3)cc2)C=CC=C1 |
| InChI | InChI=1S/C21H24N2O7S/c1-28-20(24)18-7-3-4-12-23(19(18)21(25)29-2)15-8-10-17(11-9-15)31(26,27)22-14-16-6-5-13-30-16/h3-4,7-12,16,22H,5-6,13-14H2,1-2H3 |
| InChIKey | CYPRSJQMJXOBND-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |