C22H18Cl2N2O6S — CID 168648213
dimethyl 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648213) has the molecular formula C22H18Cl2N2O6S and a molecular weight of 509.37 g/mol. Its IUPAC name is dimethyl 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168648213 |
| Molecular Formula | C22H18Cl2N2O6S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | dimethyl 1-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)C=CC=C1 |
| InChI | InChI=1S/C22H18Cl2N2O6S/c1-31-21(27)19-5-3-4-10-26(20(19)22(28)32-2)17-6-8-18(9-7-17)33(29,30)25-16-12-14(23)11-15(24)13-16/h3-13,25H,1-2H3 |
| InChIKey | QUXJDLUVJVXCNR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |