C17H15F2NO5 — CID 168650567
dimethyl 1-(3,4-difluoro-5-methoxyphenyl)azepine-2,3-dicarboxylate (PubChem CID 168650567) has the molecular formula C17H15F2NO5 and a molecular weight of 351.31 g/mol. Its IUPAC name is dimethyl 1-(3,4-difluoro-5-methoxyphenyl)azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3,4-difluoro-5-methoxyphenyl)azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650567 |
| Molecular Formula | C17H15F2NO5 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | dimethyl 1-(3,4-difluoro-5-methoxyphenyl)azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)c(F)c(OC)c2)C=CC=C1 |
| InChI | InChI=1S/C17H15F2NO5/c1-23-13-9-10(8-12(18)14(13)19)20-7-5-4-6-11(16(21)24-2)15(20)17(22)25-3/h4-9H,1-3H3 |
| InChIKey | NJJVPHIEPDGQMO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |