C22H14F5NO4S — CID 168649676
dimethyl 1-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]azepine-2,3-dicarboxylate (PubChem CID 168649676) has the molecular formula C22H14F5NO4S and a molecular weight of 483.41 g/mol. Its IUPAC name is dimethyl 1-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168649676 |
| Molecular Formula | C22H14F5NO4S |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | dimethyl 1-[4-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Sc3c(F)c(F)c(F)c(F)c3F)cc2)C=CC=C1 |
| InChI | InChI=1S/C22H14F5NO4S/c1-31-21(29)13-5-3-4-10-28(19(13)22(30)32-2)11-6-8-12(9-7-11)33-20-17(26)15(24)14(23)16(25)18(20)27/h3-10H,1-2H3 |
| InChIKey | KXYHYLBKPCGMJM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|