C23H26N2O6 — CID 168646329
3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-4-(4-methylpiperidin-1-yl)benzoic acid (PubChem CID 168646329) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-4-(4-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-4-(4-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 168646329 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[2,3-bis(methoxycarbonyl)azepin-1-yl]-4-(4-methylpiperidin-1-yl)benzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(=O)O)ccc2N2CCC(C)CC2)C=CC=C1 |
| InChI | InChI=1S/C23H26N2O6/c1-15-9-12-24(13-10-15)18-8-7-16(21(26)27)14-19(18)25-11-5-4-6-17(22(28)30-2)20(25)23(29)31-3/h4-8,11,14-15H,9-10,12-13H2,1-3H3,(H,26,27) |
| InChIKey | QMPMJGQQIPIPGW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |