C24H29N5O9 — CID 158405345
N,N-dimethyl-3-morpholin-4-yl-5-nitrobenzamide;3-morpholin-4-yl-5-nitrobenzoic acid (PubChem CID 158405345) has the molecular formula C24H29N5O9 and a molecular weight of 531.52 g/mol. Its IUPAC name is N,N-dimethyl-3-morpholin-4-yl-5-nitrobenzamide;3-morpholin-4-yl-5-nitrobenzoic acid.
| Compound Name | N,N-dimethyl-3-morpholin-4-yl-5-nitrobenzamide;3-morpholin-4-yl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 158405345 |
| Molecular Formula | C24H29N5O9 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | N,N-dimethyl-3-morpholin-4-yl-5-nitrobenzamide;3-morpholin-4-yl-5-nitrobenzoic acid |
| SMILES | CN(C)C(=O)c1cc(N2CCOCC2)cc([N+](=O)[O-])c1.O=C(O)c1cc(N2CCOCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O4.C11H12N2O5/c1-14(2)13(17)10-7-11(9-12(8-10)16(18)19)15-3-5-20-6-4-15;14-11(15)8-5-9(7-10(6-8)13(16)17)12-1-3-18-4-2-12/h7-9H,3-6H2,1-2H3;5-7H,1-4H2,(H,14,15) |
| InChIKey | GYPRRPFFZVRVGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 168.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|