C13H12N2O9S — CID 14214273
(2,5-dioxopyrrolidin-1-yl) 2-(4-nitrophenyl)sulfonylethyl carbonate (PubChem CID 14214273) has the molecular formula C13H12N2O9S and a molecular weight of 372.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(4-nitrophenyl)sulfonylethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-nitrophenyl)sulfonylethyl carbonate |
|---|---|
| PubChem CID | 14214273 |
| Molecular Formula | C13H12N2O9S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-nitrophenyl)sulfonylethyl carbonate |
| SMILES | O=C(OCCS(=O)(=O)c1ccc([N+](=O)[O-])cc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H12N2O9S/c16-11-5-6-12(17)14(11)24-13(18)23-7-8-25(21,22)10-3-1-9(2-4-10)15(19)20/h1-4H,5-8H2 |
| InChIKey | QRNXTAUKJZVNCR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|