About 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate
2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate (PubChem CID 87222562) has the molecular formula C9H10N2O7S
and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate |
| PubChem CID | 87222562 |
| Molecular Formula | C9H10N2O7S |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate |
| SMILES | NC(=O)OOCCS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H10N2O7S/c10-9(12)18-17-5-6-19(15,16)8-3-1-7(2-4-8)11(13)14/h1-4H,5-6H2,(H2,10,12) |
| InChIKey | USCDQYHZQSCRPC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate?
The IUPAC name of 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate (CID 87222562) is 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate.
What is the SMILES notation for 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate?
The canonical SMILES for 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate is NC(=O)OOCCS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate?
The InChIKey is USCDQYHZQSCRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O7S/c10-9(12)18-17-5-6-19(15,16)8-3-1-7(2-4-8)11(13)14/h1-4H,5-6H2,(H2,10,12).
What are the key properties of 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate?
2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate has a molecular weight of 290.25 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)sulfonylethyl carbamoperoxoate is sourced from PubChem (CID 87222562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).