C18H24N2O10S — CID 134920353
(2S)-5-[(2-methylpropan-2-yl)oxy]-2-[2-(4-nitrophenyl)sulfonylethoxycarbonylamino]-5-oxopentanoic acid (PubChem CID 134920353) has the molecular formula C18H24N2O10S and a molecular weight of 460.46 g/mol. Its IUPAC name is (2S)-5-[(2-methylpropan-2-yl)oxy]-2-[2-(4-nitrophenyl)sulfonylethoxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-[(2-methylpropan-2-yl)oxy]-2-[2-(4-nitrophenyl)sulfonylethoxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134920353 |
| Molecular Formula | C18H24N2O10S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (2S)-5-[(2-methylpropan-2-yl)oxy]-2-[2-(4-nitrophenyl)sulfonylethoxycarbonylamino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OCCS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C18H24N2O10S/c1-18(2,3)30-15(21)9-8-14(16(22)23)19-17(24)29-10-11-31(27,28)13-6-4-12(5-7-13)20(25)26/h4-7,14H,8-11H2,1-3H3,(H,19,24)(H,22,23)/t14-/m0/s1 |
| InChIKey | OXAKEAVKSSCDTQ-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|