C17H16N2O6S2 — CID 10386728
2-[[2-[(2-nitrophenyl)disulfanyl]-1-phenylethoxy]carbonylamino]acetic acid (PubChem CID 10386728) has the molecular formula C17H16N2O6S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[[2-[(2-nitrophenyl)disulfanyl]-1-phenylethoxy]carbonylamino]acetic acid.
| Compound Name | 2-[[2-[(2-nitrophenyl)disulfanyl]-1-phenylethoxy]carbonylamino]acetic acid |
|---|---|
| PubChem CID | 10386728 |
| Molecular Formula | C17H16N2O6S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-[[2-[(2-nitrophenyl)disulfanyl]-1-phenylethoxy]carbonylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)OC(CSSc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H16N2O6S2/c20-16(21)10-18-17(22)25-14(12-6-2-1-3-7-12)11-26-27-15-9-5-4-8-13(15)19(23)24/h1-9,14H,10-11H2,(H,18,22)(H,20,21) |
| InChIKey | GGDGDOJPQIGERA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|